C20H23FN2O4 — CID 7699952
N-(2-fluorophenyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]oxyacetamide (PubChem CID 7699952) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]oxyacetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 7699952 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]oxyacetamide |
| SMILES | COc1cc(/C=N\OCC(=O)Nc2ccccc2F)ccc1OCC(C)C |
| InChI | InChI=1S/C20H23FN2O4/c1-14(2)12-26-18-9-8-15(10-19(18)25-3)11-22-27-13-20(24)23-17-7-5-4-6-16(17)21/h4-11,14H,12-13H2,1-3H3,(H,23,24)/b22-11- |
| InChIKey | VKBFMQFOFQMYJK-JJFYIABZSA-N |
| XLogP | 3.86 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|