C13H21N5O — CID 77011852
N'-hydroxy-2-[4-(2-pyridin-3-ylethyl)piperazin-1-yl]ethanimidamide (PubChem CID 77011852) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(2-pyridin-3-ylethyl)piperazin-1-yl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-(2-pyridin-3-ylethyl)piperazin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 77011852 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N'-hydroxy-2-[4-(2-pyridin-3-ylethyl)piperazin-1-yl]ethanimidamide |
| SMILES | NC(CN1CCN(CCc2cccnc2)CC1)=NO |
| InChI | InChI=1S/C13H21N5O/c14-13(16-19)11-18-8-6-17(7-9-18)5-3-12-2-1-4-15-10-12/h1-2,4,10,19H,3,5-9,11H2,(H2,14,16) |
| InChIKey | WEHGYHKMODJSQV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|