C15H20ClN2O+ — CID 7702142
(2R)-2-chloro-2-[(R)-morpholin-4-ium-4-yl(phenyl)methyl]butanenitrile (PubChem CID 7702142) has the molecular formula C15H20ClN2O+ and a molecular weight of 279.79 g/mol. Its IUPAC name is (2R)-2-chloro-2-[(R)-morpholin-4-ium-4-yl(phenyl)methyl]butanenitrile.
| Compound Name | (2R)-2-chloro-2-[(R)-morpholin-4-ium-4-yl(phenyl)methyl]butanenitrile |
|---|---|
| PubChem CID | 7702142 |
| Molecular Formula | C15H20ClN2O+ |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2R)-2-chloro-2-[(R)-morpholin-4-ium-4-yl(phenyl)methyl]butanenitrile |
| SMILES | CC[C@](Cl)(C#N)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H19ClN2O/c1-2-15(16,12-17)14(13-6-4-3-5-7-13)18-8-10-19-11-9-18/h3-7,14H,2,8-11H2,1H3/p+1/t14-,15+/m1/s1 |
| InChIKey | JGSIPKUUXKQROQ-CABCVRRESA-O |
| XLogP | 1.55 |
| TPSA | 37.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|