C15H17Cl2NO2 — CID 77022002
3-(3,4-dichlorophenyl)-N-[(1-hydroxycyclopentyl)methyl]prop-2-enamide (PubChem CID 77022002) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[(1-hydroxycyclopentyl)methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[(1-hydroxycyclopentyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 77022002 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[(1-hydroxycyclopentyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCC1(O)CCCC1 |
| InChI | InChI=1S/C15H17Cl2NO2/c16-12-5-3-11(9-13(12)17)4-6-14(19)18-10-15(20)7-1-2-8-15/h3-6,9,20H,1-2,7-8,10H2,(H,18,19) |
| InChIKey | BHWUQBHZZJTICR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|