C17H22ClNO2 — CID 77056877
3-(4-chlorophenyl)-N-[(1-hydroxy-3-methylcyclohexyl)methyl]prop-2-enamide (PubChem CID 77056877) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(1-hydroxy-3-methylcyclohexyl)methyl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(1-hydroxy-3-methylcyclohexyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 77056877 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(1-hydroxy-3-methylcyclohexyl)methyl]prop-2-enamide |
| SMILES | CC1CCCC(O)(CNC(=O)C=Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H22ClNO2/c1-13-3-2-10-17(21,11-13)12-19-16(20)9-6-14-4-7-15(18)8-5-14/h4-9,13,21H,2-3,10-12H2,1H3,(H,19,20) |
| InChIKey | CPSBPEMKTJMPIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|