C9H11F2N3O — CID 77028561
2-(2,6-difluoroanilino)-N'-hydroxypropanimidamide (PubChem CID 77028561) has the molecular formula C9H11F2N3O and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)-N'-hydroxypropanimidamide.
| Compound Name | 2-(2,6-difluoroanilino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77028561 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(2,6-difluoroanilino)-N'-hydroxypropanimidamide |
| SMILES | CC(Nc1c(F)cccc1F)C(N)=NO |
| InChI | InChI=1S/C9H11F2N3O/c1-5(9(12)14-15)13-8-6(10)3-2-4-7(8)11/h2-5,13,15H,1H3,(H2,12,14) |
| InChIKey | VUGNZDXOPBXDKT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|