C11H12F2N2 — CID 82126738
2-(2,6-difluoroanilino)-3-methylbutanenitrile (PubChem CID 82126738) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)-3-methylbutanenitrile.
| Compound Name | 2-(2,6-difluoroanilino)-3-methylbutanenitrile |
|---|---|
| PubChem CID | 82126738 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(2,6-difluoroanilino)-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H12F2N2/c1-7(2)10(6-14)15-11-8(12)4-3-5-9(11)13/h3-5,7,10,15H,1-2H3 |
| InChIKey | BKNQGCWAHOSIPU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |