C7H10BrN3OS — CID 77030355
2-[(5-bromothiophen-2-yl)methylamino]-N'-hydroxyethanimidamide (PubChem CID 77030355) has the molecular formula C7H10BrN3OS and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77030355 |
| Molecular Formula | C7H10BrN3OS |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methylamino]-N'-hydroxyethanimidamide |
| SMILES | NC(CNCc1ccc(Br)s1)=NO |
| InChI | InChI=1S/C7H10BrN3OS/c8-6-2-1-5(13-6)3-10-4-7(9)11-12/h1-2,10,12H,3-4H2,(H2,9,11) |
| InChIKey | PRJGIYCZDHJMIG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|