C11H16BrN3OS — CID 77071211
2-[1-[[(5-bromothiophen-2-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77071211) has the molecular formula C11H16BrN3OS and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-[1-[[(5-bromothiophen-2-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[(5-bromothiophen-2-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77071211 |
| Molecular Formula | C11H16BrN3OS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 2-[1-[[(5-bromothiophen-2-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNCc2ccc(Br)s2)CC1)=NO |
| InChI | InChI=1S/C11H16BrN3OS/c12-9-2-1-8(17-9)6-14-7-11(3-4-11)5-10(13)15-16/h1-2,14,16H,3-7H2,(H2,13,15) |
| InChIKey | KMQYUIFHCXIQQY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|