C6H14N4O2 — CID 77031454
2-[(2-amino-2-hydroxyiminoethyl)amino]-N-methylpropanamide (PubChem CID 77031454) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(2-amino-2-hydroxyiminoethyl)amino]-N-methylpropanamide.
| Compound Name | 2-[(2-amino-2-hydroxyiminoethyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 77031454 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 2-[(2-amino-2-hydroxyiminoethyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(N)=NO |
| InChI | InChI=1S/C6H14N4O2/c1-4(6(11)8-2)9-3-5(7)10-12/h4,9,12H,3H2,1-2H3,(H2,7,10)(H,8,11) |
| InChIKey | JMYGBXOCQLCYDI-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|