C12H10N6OS — CID 77034316
N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)quinoline-3-carboximidamide (PubChem CID 77034316) has the molecular formula C12H10N6OS and a molecular weight of 286.32 g/mol. Its IUPAC name is N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)quinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 77034316 |
| Molecular Formula | C12H10N6OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N'-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)quinoline-3-carboximidamide |
| SMILES | NC(=NO)c1cc2ccccc2nc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C12H10N6OS/c13-10(18-19)8-5-7-3-1-2-4-9(7)16-11(8)20-12-14-6-15-17-12/h1-6,19H,(H2,13,18)(H,14,15,17) |
| InChIKey | PBYZCSXJGUAGTO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|