C8H9N7OS — CID 136678332
N'-hydroxy-6-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine-4-carboximidamide (PubChem CID 136678332) has the molecular formula C8H9N7OS and a molecular weight of 251.28 g/mol. Its IUPAC name is N'-hydroxy-6-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-6-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136678332 |
| Molecular Formula | C8H9N7OS |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N'-hydroxy-6-methyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)pyrimidine-4-carboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)nc(Sc2ncn[nH]2)n1 |
| InChI | InChI=1S/C8H9N7OS/c1-4-2-5(6(9)15-16)13-8(12-4)17-7-10-3-11-14-7/h2-3,16H,1H3,(H2,9,15)(H,10,11,14) |
| InChIKey | FTHLVOHDKYICSI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|