C16H19BrN6O2 — CID 7704181
(5R)-5-(3-bromophenyl)-3-[(1-butyltetrazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7704181) has the molecular formula C16H19BrN6O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is (5R)-5-(3-bromophenyl)-3-[(1-butyltetrazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3-bromophenyl)-3-[(1-butyltetrazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7704181 |
| Molecular Formula | C16H19BrN6O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (5R)-5-(3-bromophenyl)-3-[(1-butyltetrazol-5-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCn1nnnc1CN1C(=O)N[C@](C)(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C16H19BrN6O2/c1-3-4-8-23-13(19-20-21-23)10-22-14(24)16(2,18-15(22)25)11-6-5-7-12(17)9-11/h5-7,9H,3-4,8,10H2,1-2H3,(H,18,25)/t16-/m1/s1 |
| InChIKey | VFZISYORDJNSAR-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|