C19H26N6O2 — CID 41188429
(5S)-5-(4-tert-butylphenyl)-5-methyl-3-[(1-propyltetrazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 41188429) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is (5S)-5-(4-tert-butylphenyl)-5-methyl-3-[(1-propyltetrazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-tert-butylphenyl)-5-methyl-3-[(1-propyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41188429 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (5S)-5-(4-tert-butylphenyl)-5-methyl-3-[(1-propyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCCn1nnnc1CN1C(=O)N[C@@](C)(c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C19H26N6O2/c1-6-11-25-15(21-22-23-25)12-24-16(26)19(5,20-17(24)27)14-9-7-13(8-10-14)18(2,3)4/h7-10H,6,11-12H2,1-5H3,(H,20,27)/t19-/m0/s1 |
| InChIKey | BNGSSKASPATHOH-IBGZPJMESA-N |
| XLogP | 2.35 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|