C22H18N6O2 — CID 41157273
(5S)-5-methyl-5-naphthalen-2-yl-3-[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 41157273) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is (5S)-5-methyl-5-naphthalen-2-yl-3-[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-naphthalen-2-yl-3-[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41157273 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (5S)-5-methyl-5-naphthalen-2-yl-3-[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc3ccccc3c2)NC(=O)N(Cc2nnnn2-c2ccccc2)C1=O |
| InChI | InChI=1S/C22H18N6O2/c1-22(17-12-11-15-7-5-6-8-16(15)13-17)20(29)27(21(30)23-22)14-19-24-25-26-28(19)18-9-3-2-4-10-18/h2-13H,14H2,1H3,(H,23,30)/t22-/m0/s1 |
| InChIKey | HWJMEGVEDJFNLQ-QFIPXVFZSA-N |
| XLogP | 2.78 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|