C29H28N10O4 — CID 98371326
(5R)-5-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,3-bis[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 98371326) has the molecular formula C29H28N10O4 and a molecular weight of 580.61 g/mol. Its IUPAC name is (5R)-5-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,3-bis[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,3-bis[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98371326 |
| Molecular Formula | C29H28N10O4 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (5R)-5-[(3,4-dimethoxyphenyl)methyl]-5-methyl-1,3-bis[(1-phenyltetrazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C[C@]2(C)C(=O)N(Cc3nnnn3-c3ccccc3)C(=O)N2Cc2nnnn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H28N10O4/c1-29(17-20-14-15-23(42-2)24(16-20)43-3)27(40)36(18-25-30-32-34-38(25)21-10-6-4-7-11-21)28(41)37(29)19-26-31-33-35-39(26)22-12-8-5-9-13-22/h4-16H,17-19H2,1-3H3/t29-/m1/s1 |
| InChIKey | VHZKZUZQYNINQR-GDLZYMKVSA-N |
| XLogP | 2.62 |
| TPSA | 146.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|