About disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate
disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate (PubChem CID 77050796) has the molecular formula C18H17N2Na2O7P
and a molecular weight of 450.30 g/mol. Its IUPAC name is disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate.
Molecular Properties
| Compound Name | disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate |
| PubChem CID | 77050796 |
| Molecular Formula | C18H17N2Na2O7P |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate |
| SMILES | COc1cc(OC)cc(-c2nc[nH]c2-c2ccc(OC)c(OP(=O)([O-])[O-])c2)c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H19N2O7P.2Na/c1-24-13-6-12(7-14(9-13)25-2)18-17(19-10-20-18)11-4-5-15(26-3)16(8-11)27-28(21,22)23;;/h4-10H,1-3H3,(H,19,20)(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | DMSYYHRIGXVRHA-UHFFFAOYSA-L |
| XLogP | -4.01 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate?
The IUPAC name of disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate (CID 77050796) is disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate.
What is the SMILES notation for disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate?
The canonical SMILES for disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate is COc1cc(OC)cc(-c2nc[nH]c2-c2ccc(OC)c(OP(=O)([O-])[O-])c2)c1.[Na+].[Na+].
What is the InChIKey of disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate?
The InChIKey is DMSYYHRIGXVRHA-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H19N2O7P.2Na/c1-24-13-6-12(7-14(9-13)25-2)18-17(19-10-20-18)11-4-5-15(26-3)16(8-11)27-28(21,22)23;;/h4-10H,1-3H3,(H,19,20)(H2,21,22,23);;/q;2*+1/p-2.
What are the key properties of disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate?
disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate has a molecular weight of 450.30 g/mol, XLogP of -4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate is sourced from PubChem (CID 77050796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).