C18H17N2Na2O7P — CID 77050796
disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate (PubChem CID 77050796) has the molecular formula C18H17N2Na2O7P and a molecular weight of 450.30 g/mol. Its IUPAC name is disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate.
| Compound Name | disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate |
|---|---|
| PubChem CID | 77050796 |
| Molecular Formula | C18H17N2Na2O7P |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | disodium;[5-[4-(3,5-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methoxyphenyl] phosphate |
| SMILES | COc1cc(OC)cc(-c2nc[nH]c2-c2ccc(OC)c(OP(=O)([O-])[O-])c2)c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H19N2O7P.2Na/c1-24-13-6-12(7-14(9-13)25-2)18-17(19-10-20-18)11-4-5-15(26-3)16(8-11)27-28(21,22)23;;/h4-10H,1-3H3,(H,19,20)(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | DMSYYHRIGXVRHA-UHFFFAOYSA-L |
| XLogP | -4.01 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|