C14H13Cl2NO4 — CID 77058566
3-[3-(2,4-dichlorophenyl)prop-2-enoylamino]oxolane-3-carboxylic acid (PubChem CID 77058566) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenyl)prop-2-enoylamino]oxolane-3-carboxylic acid.
| Compound Name | 3-[3-(2,4-dichlorophenyl)prop-2-enoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 77058566 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[3-(2,4-dichlorophenyl)prop-2-enoylamino]oxolane-3-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C14H13Cl2NO4/c15-10-3-1-9(11(16)7-10)2-4-12(18)17-14(13(19)20)5-6-21-8-14/h1-4,7H,5-6,8H2,(H,17,18)(H,19,20) |
| InChIKey | IYGHMFWIZCPUSB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|