C9H18N4 — CID 77060123
2-[(3,3-dimethylcyclohexylidene)amino]guanidine (PubChem CID 77060123) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclohexylidene)amino]guanidine.
| Compound Name | 2-[(3,3-dimethylcyclohexylidene)amino]guanidine |
|---|---|
| PubChem CID | 77060123 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-[(3,3-dimethylcyclohexylidene)amino]guanidine |
| SMILES | CC1(C)CCCC(=NN=C(N)N)C1 |
| InChI | InChI=1S/C9H18N4/c1-9(2)5-3-4-7(6-9)12-13-8(10)11/h3-6H2,1-2H3,(H4,10,11,13) |
| InChIKey | TZPAZOMBOQQLJF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|