C6H11N5O2S — CID 77061012
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] N'-aminocarbamimidothioate (PubChem CID 77061012) has the molecular formula C6H11N5O2S and a molecular weight of 217.25 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77061012 |
| Molecular Formula | C6H11N5O2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C6H11N5O2S/c7-5(10-8)14-3-4(12)11-2-1-9-6(11)13/h1-3,8H2,(H2,7,10)(H,9,13) |
| InChIKey | UZSUEQRSKYHGOB-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|