C12H20N4O3 — CID 77066461
N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopentane-1-carboximidamide (PubChem CID 77066461) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopentane-1-carboximidamide.
| Compound Name | N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 77066461 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopentane-1-carboximidamide |
| SMILES | NC(=NO)C1(C(=O)N2CCCNC(=O)C2)CCCC1 |
| InChI | InChI=1S/C12H20N4O3/c13-10(15-19)12(4-1-2-5-12)11(18)16-7-3-6-14-9(17)8-16/h19H,1-8H2,(H2,13,15)(H,14,17) |
| InChIKey | UWGWJVREDYMVCP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|