C10H16N4O3 — CID 80594554
N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopropane-1-carboximidamide (PubChem CID 80594554) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopropane-1-carboximidamide.
| Compound Name | N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 80594554 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N'-hydroxy-1-(3-oxo-1,4-diazepane-1-carbonyl)cyclopropane-1-carboximidamide |
| SMILES | NC(=NO)C1(C(=O)N2CCCNC(=O)C2)CC1 |
| InChI | InChI=1S/C10H16N4O3/c11-8(13-17)10(2-3-10)9(16)14-5-1-4-12-7(15)6-14/h17H,1-6H2,(H2,11,13)(H,12,15) |
| InChIKey | XJJVCMVMLXLIMT-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|