C15H23N3O5S2 — CID 77096309
3-[(3R)-3-methylpiperazin-1-yl]sulfonyl-N-(2-methylsulfonylethyl)benzamide (PubChem CID 77096309) has the molecular formula C15H23N3O5S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[(3R)-3-methylpiperazin-1-yl]sulfonyl-N-(2-methylsulfonylethyl)benzamide.
| Compound Name | 3-[(3R)-3-methylpiperazin-1-yl]sulfonyl-N-(2-methylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 77096309 |
| Molecular Formula | C15H23N3O5S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3-[(3R)-3-methylpiperazin-1-yl]sulfonyl-N-(2-methylsulfonylethyl)benzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(C(=O)NCCS(C)(=O)=O)c2)CCN1 |
| InChI | InChI=1S/C15H23N3O5S2/c1-12-11-18(8-6-16-12)25(22,23)14-5-3-4-13(10-14)15(19)17-7-9-24(2,20)21/h3-5,10,12,16H,6-9,11H2,1-2H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | NOICCFQYQBUZQQ-GFCCVEGCSA-N |
| XLogP | -0.56 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |