C10H14N2O4 — CID 77101051
methyl 4-(2,5-dioxoimidazolidin-1-yl)-2-ethylbut-2-enoate (PubChem CID 77101051) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 4-(2,5-dioxoimidazolidin-1-yl)-2-ethylbut-2-enoate.
| Compound Name | methyl 4-(2,5-dioxoimidazolidin-1-yl)-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 77101051 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl 4-(2,5-dioxoimidazolidin-1-yl)-2-ethylbut-2-enoate |
| SMILES | CCC(=CCN1C(=O)CNC1=O)C(=O)OC |
| InChI | InChI=1S/C10H14N2O4/c1-3-7(9(14)16-2)4-5-12-8(13)6-11-10(12)15/h4H,3,5-6H2,1-2H3,(H,11,15) |
| InChIKey | IYUUIIJDZDSUBX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|