C18H13N3O2 — CID 77105815
1,8-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile (PubChem CID 77105815) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1,8-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile.
| Compound Name | 1,8-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile |
|---|---|
| PubChem CID | 77105815 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1,8-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile |
| SMILES | COc1ccc2[nH]c3c4c(OC)cncc4cc(C#N)c3c2c1 |
| InChI | InChI=1S/C18H13N3O2/c1-22-12-3-4-14-13(6-12)16-10(7-19)5-11-8-20-9-15(23-2)17(11)18(16)21-14/h3-6,8-9,21H,1-2H3 |
| InChIKey | VTDMTVMKVZXVSP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |