C18H15N3O3 — CID 77105819
1,9-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide (PubChem CID 77105819) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1,9-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide.
| Compound Name | 1,9-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide |
|---|---|
| PubChem CID | 77105819 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1,9-dimethoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide |
| SMILES | COc1ccc2c(c1)[nH]c1c3c(OC)cncc3cc(C(N)=O)c21 |
| InChI | InChI=1S/C18H15N3O3/c1-23-10-3-4-11-13(6-10)21-17-15-9(7-20-8-14(15)24-2)5-12(16(11)17)18(19)22/h3-8,21H,1-2H3,(H2,19,22) |
| InChIKey | XVSFEEKLBPRHRF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |