C12H17NO3 — CID 77110073
3-(hexa-2,4-dienoylamino)cyclopentane-1-carboxylic acid (PubChem CID 77110073) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(hexa-2,4-dienoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(hexa-2,4-dienoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 77110073 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(hexa-2,4-dienoylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-4-5-11(14)13-10-7-6-9(8-10)12(15)16/h2-5,9-10H,6-8H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FAEVXYYRZQPSAM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|