C23H22N4O3 — CID 77193641
3-(2'-amino-1',10a-dimethyl-5'-oxospiro[1,3,4,4a-tetrahydropyrano[4,3-b]chromene-10,4'-imidazole]-8-yl)benzonitrile (PubChem CID 77193641) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-(2'-amino-1',10a-dimethyl-5'-oxospiro[1,3,4,4a-tetrahydropyrano[4,3-b]chromene-10,4'-imidazole]-8-yl)benzonitrile.
| Compound Name | 3-(2'-amino-1',10a-dimethyl-5'-oxospiro[1,3,4,4a-tetrahydropyrano[4,3-b]chromene-10,4'-imidazole]-8-yl)benzonitrile |
|---|---|
| PubChem CID | 77193641 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(2'-amino-1',10a-dimethyl-5'-oxospiro[1,3,4,4a-tetrahydropyrano[4,3-b]chromene-10,4'-imidazole]-8-yl)benzonitrile |
| SMILES | CN1C(=O)C2(N=C1N)c1cc(-c3cccc(C#N)c3)ccc1OC1CCOCC12C |
| InChI | InChI=1S/C23H22N4O3/c1-22-13-29-9-8-19(22)30-18-7-6-16(15-5-3-4-14(10-15)12-24)11-17(18)23(22)20(28)27(2)21(25)26-23/h3-7,10-11,19H,8-9,13H2,1-2H3,(H2,25,26) |
| InChIKey | CUTSLGOTJVDALL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |