C16H23ClNO2+ — CID 7721825
[(1R,2R)-2-(2-chlorobenzoyl)oxycyclohexyl]methyl-dimethylazanium (PubChem CID 7721825) has the molecular formula C16H23ClNO2+ and a molecular weight of 296.82 g/mol. Its IUPAC name is [(1R,2R)-2-(2-chlorobenzoyl)oxycyclohexyl]methyl-dimethylazanium.
| Compound Name | [(1R,2R)-2-(2-chlorobenzoyl)oxycyclohexyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 7721825 |
| Molecular Formula | C16H23ClNO2+ |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(1R,2R)-2-(2-chlorobenzoyl)oxycyclohexyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)C[C@H]1CCCC[C@H]1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClNO2/c1-18(2)11-12-7-3-6-10-15(12)20-16(19)13-8-4-5-9-14(13)17/h4-5,8-9,12,15H,3,6-7,10-11H2,1-2H3/p+1/t12-,15-/m1/s1 |
| InChIKey | AJNYCRJSZDYTHX-IUODEOHRSA-O |
| XLogP | 2.20 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |