C23H29N2O2+ — CID 7730793
(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol (PubChem CID 7730793) has the molecular formula C23H29N2O2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is (2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol.
| Compound Name | (2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
|---|---|
| PubChem CID | 7730793 |
| Molecular Formula | C23H29N2O2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]-3-(fluoren-9-ylideneamino)oxypropan-2-ol |
| SMILES | C[C@@H]1C[C@@H](C)C[NH+](C[C@H](O)CON=C2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C23H28N2O2/c1-16-11-17(2)13-25(12-16)14-18(26)15-27-24-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-10,16-18,26H,11-15H2,1-2H3/p+1/t16-,17-,18+/m1/s1 |
| InChIKey | LSCGZJZKKAPTNP-KURKYZTESA-O |
| XLogP | 2.36 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|