C24H31N3O2+2 — CID 7730825
(2R)-1-(fluoren-9-ylideneamino)oxy-3-[4-(2-methylprop-2-enyl)piperazine-1,4-diium-1-yl]propan-2-ol (PubChem CID 7730825) has the molecular formula C24H31N3O2+2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R)-1-(fluoren-9-ylideneamino)oxy-3-[4-(2-methylprop-2-enyl)piperazine-1,4-diium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(fluoren-9-ylideneamino)oxy-3-[4-(2-methylprop-2-enyl)piperazine-1,4-diium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7730825 |
| Molecular Formula | C24H31N3O2+2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (2R)-1-(fluoren-9-ylideneamino)oxy-3-[4-(2-methylprop-2-enyl)piperazine-1,4-diium-1-yl]propan-2-ol |
| SMILES | C=C(C)C[NH+]1CC[NH+](C[C@@H](O)CON=C2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-18(2)15-26-11-13-27(14-12-26)16-19(28)17-29-25-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-10,19,28H,1,11-17H2,2H3/p+2/t19-/m1/s1 |
| InChIKey | XGLCTIBCAKEPDC-LJQANCHMSA-P |
| XLogP | 0.16 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|