C26H22NO2S+ — CID 7731914
2-[(E)-[6-methoxy-2-(4-methylphenyl)chromen-4-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 7731914) has the molecular formula C26H22NO2S+ and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[(E)-[6-methoxy-2-(4-methylphenyl)chromen-4-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-[6-methoxy-2-(4-methylphenyl)chromen-4-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 7731914 |
| Molecular Formula | C26H22NO2S+ |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[(E)-[6-methoxy-2-(4-methylphenyl)chromen-4-ylidene]methyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | COc1ccc2c(c1)/C(=C/c1sc3ccccc3[n+]1C)C=C(c1ccc(C)cc1)O2 |
| InChI | InChI=1S/C26H22NO2S/c1-17-8-10-18(11-9-17)24-14-19(21-16-20(28-3)12-13-23(21)29-24)15-26-27(2)22-6-4-5-7-25(22)30-26/h4-16H,1-3H3/q+1/b19-15+ |
| InChIKey | UAVHTTMUHKHXSG-XDJHFCHBSA-N |
| XLogP | 6.02 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|