C19H21N5O2 — CID 77393160
2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-8-carbonitrile (PubChem CID 77393160) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-8-carbonitrile.
| Compound Name | 2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 77393160 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2,6,6,9a-tetramethyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-7-oxo-5,5a-dihydro-4H-benzo[g]indazole-8-carbonitrile |
| SMILES | Cc1nnc(-c2c3c(nn2C)C2(C)C=C(C#N)C(=O)C(C)(C)C2CC3)o1 |
| InChI | InChI=1S/C19H21N5O2/c1-10-21-22-17(26-10)14-12-6-7-13-18(2,3)16(25)11(9-20)8-19(13,4)15(12)23-24(14)5/h8,13H,6-7H2,1-5H3 |
| InChIKey | LKTBHVAFXNABAS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |