C19H18F3NO5 — CID 77398610
methyl 7-hydroxy-9-(trifluoromethoxy)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate (PubChem CID 77398610) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is methyl 7-hydroxy-9-(trifluoromethoxy)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate.
| Compound Name | methyl 7-hydroxy-9-(trifluoromethoxy)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 77398610 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 7-hydroxy-9-(trifluoromethoxy)-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
| SMILES | COC(=O)N1CCC23c4c5ccc(OC(F)(F)F)c4OC2C(O)C=CC3C1C5 |
| InChI | InChI=1S/C19H18F3NO5/c1-26-17(25)23-7-6-18-10-3-4-12(24)16(18)27-15-13(28-19(20,21)22)5-2-9(14(15)18)8-11(10)23/h2-5,10-12,16,24H,6-8H2,1H3 |
| InChIKey | FHNOPTNVTYGMGW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|