C24H20N6O4 — CID 77399585
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[2-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 77399585) has the molecular formula C24H20N6O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[2-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[2-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 77399585 |
| Molecular Formula | C24H20N6O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[2-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(C#Cc3cccnc3-c3cnn(C)c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C24H20N6O4/c1-29-12-17(11-26-29)20-15(4-3-9-25-20)7-8-24(22(32)27-23(33)28-24)14-30-13-16-5-6-18(34-2)10-19(16)21(30)31/h3-6,9-12H,13-14H2,1-2H3,(H2,27,28,32,33) |
| InChIKey | ILXWMFLAZLGKIG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|