C21H20N4O4S — CID 76573529
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 76573529) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 76573529 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(C#Cc3csc(C(C)C)n3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C21H20N4O4S/c1-12(2)17-22-14(10-30-17)6-7-21(19(27)23-20(28)24-21)11-25-9-13-4-5-15(29-3)8-16(13)18(25)26/h4-5,8,10,12H,9,11H2,1-3H3,(H2,23,24,27,28) |
| InChIKey | QLFAOAZCDBUZMI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|