C25H34N2O — CID 77405712
5,10a,12a-trimethyl-1-pyridin-3-yl-2,3,3a,3b,4,5,8,9,10,10b,11,12-dodecahydro-1H-indeno[4,5-i][3]benzazepin-7-one (PubChem CID 77405712) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 5,10a,12a-trimethyl-1-pyridin-3-yl-2,3,3a,3b,4,5,8,9,10,10b,11,12-dodecahydro-1H-indeno[4,5-i][3]benzazepin-7-one.
| Compound Name | 5,10a,12a-trimethyl-1-pyridin-3-yl-2,3,3a,3b,4,5,8,9,10,10b,11,12-dodecahydro-1H-indeno[4,5-i][3]benzazepin-7-one |
|---|---|
| PubChem CID | 77405712 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 5,10a,12a-trimethyl-1-pyridin-3-yl-2,3,3a,3b,4,5,8,9,10,10b,11,12-dodecahydro-1H-indeno[4,5-i][3]benzazepin-7-one |
| SMILES | CC1CC2C(CCC3(C)C(c4cccnc4)CCC23)C2(C)CCNC(=O)C=C12 |
| InChI | InChI=1S/C25H34N2O/c1-16-13-18-20-7-6-19(17-5-4-11-26-15-17)24(20,2)9-8-21(18)25(3)10-12-27-23(28)14-22(16)25/h4-5,11,14-16,18-21H,6-10,12-13H2,1-3H3,(H,27,28) |
| InChIKey | QRRZSCRCRJXHGD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |