C29H38N2OS — CID 123429556
4-[10a,12a-dimethyl-1-(5-methyl-3-pyridinyl)-7-oxo-3a,3b,4,5,8,9,10,10b,11,12-decahydro-3H-indeno[4,5-i][3]benzazepin-5-yl]butanethial (PubChem CID 123429556) has the molecular formula C29H38N2OS and a molecular weight of 462.70 g/mol. Its IUPAC name is 4-[10a,12a-dimethyl-1-(5-methyl-3-pyridinyl)-7-oxo-3a,3b,4,5,8,9,10,10b,11,12-decahydro-3H-indeno[4,5-i][3]benzazepin-5-yl]butanethial.
| Compound Name | 4-[10a,12a-dimethyl-1-(5-methyl-3-pyridinyl)-7-oxo-3a,3b,4,5,8,9,10,10b,11,12-decahydro-3H-indeno[4,5-i][3]benzazepin-5-yl]butanethial |
|---|---|
| PubChem CID | 123429556 |
| Molecular Formula | C29H38N2OS |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 4-[10a,12a-dimethyl-1-(5-methyl-3-pyridinyl)-7-oxo-3a,3b,4,5,8,9,10,10b,11,12-decahydro-3H-indeno[4,5-i][3]benzazepin-5-yl]butanethial |
| SMILES | Cc1cncc(C2=CCC3C4CC(CCCC=S)C5=CC(=O)NCCC5(C)C4CCC23C)c1 |
| InChI | InChI=1S/C29H38N2OS/c1-19-14-21(18-30-17-19)23-7-8-24-22-15-20(6-4-5-13-33)26-16-27(32)31-12-11-29(26,3)25(22)9-10-28(23,24)2/h7,13-14,16-18,20,22,24-25H,4-6,8-12,15H2,1-3H3,(H,31,32) |
| InChIKey | NDAVEAZKBGZZLJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|