C19H19Cl2NO3 — CID 77465516
N-[1-[4-(4-acetylphenyl)phenyl]-3-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 77465516) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is N-[1-[4-(4-acetylphenyl)phenyl]-3-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[4-(4-acetylphenyl)phenyl]-3-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 77465516 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[1-[4-(4-acetylphenyl)phenyl]-3-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | CC(=O)c1ccc(-c2ccc(CC(CO)NC(=O)C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-12(24)14-6-8-16(9-7-14)15-4-2-13(3-5-15)10-17(11-23)22-19(25)18(20)21/h2-9,17-18,23H,10-11H2,1H3,(H,22,25) |
| InChIKey | PGYUMAWRCUMFKH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|