C11H12N2O4 — CID 774801
(4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 774801) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 774801 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | NC(=O)[C@H]1OC(c2ccccc2)O[C@@H]1C(N)=O |
| InChI | InChI=1S/C11H12N2O4/c12-9(14)7-8(10(13)15)17-11(16-7)6-4-2-1-3-5-6/h1-5,7-8,11H,(H2,12,14)(H2,13,15)/t7-,8-/m0/s1 |
| InChIKey | IJNZBBWZMJFJAN-YUMQZZPRSA-N |
| XLogP | -0.56 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |