C23H25ClN6O3 — CID 77495598
3-[[5-(2-chloro-3-methoxyanilino)-7-(2-methylbutylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 77495598) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is 3-[[5-(2-chloro-3-methoxyanilino)-7-(2-methylbutylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(2-chloro-3-methoxyanilino)-7-(2-methylbutylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77495598 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[[5-(2-chloro-3-methoxyanilino)-7-(2-methylbutylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCC(C)CNc1cc(Nc2cccc(OC)c2Cl)nc2c(C=C3CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C23H25ClN6O3/c1-4-13(2)11-25-19-10-18(27-16-6-5-7-17(33-3)21(16)24)28-22-15(12-26-30(19)22)8-14-9-20(31)29-23(14)32/h5-8,10,12-13,25H,4,9,11H2,1-3H3,(H,27,28)(H,29,31,32) |
| InChIKey | IVHFHIPPHCOGJM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|