C13H11N3O — CID 774969
2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline (PubChem CID 774969) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 774969 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
| SMILES | Cc1ccc(-c2nc3ncccc3o2)cc1N |
| InChI | InChI=1S/C13H11N3O/c1-8-4-5-9(7-10(8)14)13-16-12-11(17-13)3-2-6-15-12/h2-7H,14H2,1H3 |
| InChIKey | WGTVXCWMSWDXMG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|