C14H16BrN3O3 — CID 7767931
3-bromo-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide (PubChem CID 7767931) has the molecular formula C14H16BrN3O3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 3-bromo-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide.
| Compound Name | 3-bromo-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 7767931 |
| Molecular Formula | C14H16BrN3O3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-bromo-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(Br)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H16BrN3O3/c15-11-6-4-5-10(9-11)12(19)16-17-13(20)14(21)18-7-2-1-3-8-18/h4-6,9H,1-3,7-8H2,(H,16,19)(H,17,20) |
| InChIKey | NUOBYZPDBSUVHO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|