C12H13N2O7S- — CID 7771797
(3S)-1-(2-nitrophenoxy)sulfonylpiperidine-3-carboxylate (PubChem CID 7771797) has the molecular formula C12H13N2O7S- and a molecular weight of 329.31 g/mol. Its IUPAC name is (3S)-1-(2-nitrophenoxy)sulfonylpiperidine-3-carboxylate.
| Compound Name | (3S)-1-(2-nitrophenoxy)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7771797 |
| Molecular Formula | C12H13N2O7S- |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (3S)-1-(2-nitrophenoxy)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN(S(=O)(=O)Oc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H14N2O7S/c15-12(16)9-4-3-7-13(8-9)22(19,20)21-11-6-2-1-5-10(11)14(17)18/h1-2,5-6,9H,3-4,7-8H2,(H,15,16)/p-1/t9-/m0/s1 |
| InChIKey | FIGINQJEXLIFPI-VIFPVBQESA-M |
| XLogP | -0.32 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|