C20H19FO3 — CID 7786033
[(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7786033) has the molecular formula C20H19FO3 and a molecular weight of 326.37 g/mol. Its IUPAC name is [(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786033 |
| Molecular Formula | C20H19FO3 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)/C=C/c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C20H19FO3/c1-13-7-9-17(11-14(13)2)20(23)15(3)24-19(22)10-8-16-5-4-6-18(21)12-16/h4-12,15H,1-3H3/b10-8+/t15-/m1/s1 |
| InChIKey | BMZGUEUIEZPTLB-TUPIDYKKSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|