C16H20ClNO4 — CID 7791264
[(2S)-oxolan-2-yl]methyl 5-(4-chloroanilino)-5-oxopentanoate (PubChem CID 7791264) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 5-(4-chloroanilino)-5-oxopentanoate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 5-(4-chloroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 7791264 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 5-(4-chloroanilino)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OC[C@@H]1CCCO1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO4/c17-12-6-8-13(9-7-12)18-15(19)4-1-5-16(20)22-11-14-3-2-10-21-14/h6-9,14H,1-5,10-11H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | AWCCVQVMUITHBD-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |