C17H21N3O3 — CID 7798430
trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 7798430) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7798430 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)N/N=C\c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C17H21N3O3/c1-11(2)9-14-15(17(14,3)4)16(21)19-18-10-12-5-7-13(8-6-12)20(22)23/h5-10,14-15H,1-4H3,(H,19,21)/b18-10-/t14-,15-/m1/s1 |
| InChIKey | MQNYUOGAJXCNIN-SMZSATKYSA-N |
| XLogP | 3.28 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|