C21H17N2O5S- — CID 7798643
3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]pyrazol-1-yl]propanoate (PubChem CID 7798643) has the molecular formula C21H17N2O5S- and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]pyrazol-1-yl]propanoate.
| Compound Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 7798643 |
| Molecular Formula | C21H17N2O5S- |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]pyrazol-1-yl]propanoate |
| SMILES | O=C([O-])CCn1cc(/C=C/C(=O)c2cccs2)c(-c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C21H18N2O5S/c24-16(19-2-1-11-29-19)5-3-15-13-23(8-7-20(25)26)22-21(15)14-4-6-17-18(12-14)28-10-9-27-17/h1-6,11-13H,7-10H2,(H,25,26)/p-1/b5-3+ |
| InChIKey | ATICSJROXRCZCW-HWKANZROSA-M |
| XLogP | 2.42 |
| TPSA | 93.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|