C17H18BrFN2O3 — CID 7799933
1-[(4-bromo-2-fluorophenyl)methyl]-3-[(1S,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione (PubChem CID 7799933) has the molecular formula C17H18BrFN2O3 and a molecular weight of 397.24 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(1S,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(1S,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7799933 |
| Molecular Formula | C17H18BrFN2O3 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3-[(1S,2R)-2-methylcyclohexyl]imidazolidine-2,4,5-trione |
| SMILES | C[C@@H]1CCCC[C@@H]1N1C(=O)C(=O)N(Cc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C17H18BrFN2O3/c1-10-4-2-3-5-14(10)21-16(23)15(22)20(17(21)24)9-11-6-7-12(18)8-13(11)19/h6-8,10,14H,2-5,9H2,1H3/t10-,14+/m1/s1 |
| InChIKey | NNWJHABCICNLCV-YGRLFVJLSA-N |
| XLogP | 3.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|