C18H18BrF3N2O2 — CID 78018688
tert-butyl N-[(3-bromo-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 78018688) has the molecular formula C18H18BrF3N2O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is tert-butyl N-[(3-bromo-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[(3-bromo-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 78018688 |
| Molecular Formula | C18H18BrF3N2O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | tert-butyl N-[(3-bromo-2-pyridinyl)-[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccc(C(F)(F)F)cc1)c1ncccc1Br |
| InChI | InChI=1S/C18H18BrF3N2O2/c1-17(2,3)26-16(25)24-14(15-13(19)5-4-10-23-15)11-6-8-12(9-7-11)18(20,21)22/h4-10,14H,1-3H3,(H,24,25) |
| InChIKey | OXDWJKLWIWODSF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |